CymitQuimica logo

CAS 153290-82-5

:

3-Isoquinolinecarboxamide, N-(1,1-dimethylethyl)-1,2,3,4-tetrahydro-

Description:
3-Isoquinolinecarboxamide, N-(1,1-dimethylethyl)-1,2,3,4-tetrahydro- is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N). The N-(1,1-dimethylethyl) substituent suggests that the nitrogen is attached to a tert-butyl group, which contributes to the compound's steric bulk and may influence its biological activity. The tetrahydro designation indicates that the isoquinoline ring system is partially saturated, which can affect the compound's reactivity and stability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 153290-82-5, allows for precise identification in chemical databases. Overall, the unique structural features of this compound suggest potential applications in drug development and research.
Formula:C14H20N2O
InChI:InChI=1S/C14H20N2O/c1-14(2,3)16-13(17)12-8-10-6-4-5-7-11(10)9-15-12/h4-7,12,15H,8-9H2,1-3H3,(H,16,17)
InChI key:DMJXRYSGXCLCFP-UHFFFAOYSA-N
SMILES:CC(C)(C)NC(=O)C1CC2=CC=CC=C2CN1
Found 4 products.