CymitQuimica logo

CAS 153329-04-5

:

Benzonitrile, 3-(1,3-dioxolan-2-yl)-

Description:
Benzonitrile, 3-(1,3-dioxolan-2-yl)-, is an organic compound characterized by the presence of a benzonitrile moiety and a 1,3-dioxolane ring. This compound features a nitrile functional group (-C≡N) attached to a benzene ring, which contributes to its aromatic properties and potential reactivity. The 1,3-dioxolane ring, a five-membered cyclic ether, introduces unique steric and electronic characteristics, influencing the compound's solubility and reactivity. Benzonitrile derivatives are often utilized in organic synthesis and can serve as intermediates in the production of pharmaceuticals, agrochemicals, and other fine chemicals. The presence of the dioxolane ring may enhance the compound's stability and alter its interaction with biological systems. Additionally, compounds like this may exhibit specific physical properties such as boiling and melting points, which are influenced by their molecular structure. Overall, the combination of the aromatic benzonitrile and the cyclic ether structure makes this compound of interest in various chemical applications.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c11-7-8-2-1-3-9(6-8)10-12-4-5-13-10/h1-3,6,10H,4-5H2
InChI key:BYKDCLKZFBKIBQ-UHFFFAOYSA-N
SMILES:C1COC(O1)C2=CC=CC(=C2)C#N
Found 3 products.