CAS 1535-75-7
:2-Trifluoromethoxyaniline
Description:
2-Trifluoromethoxyaniline, with the CAS number 1535-75-7, is an organic compound characterized by the presence of a trifluoromethoxy group (-O-CF3) attached to an aniline structure. This compound features a benzene ring bonded to an amino group (-NH2) and a trifluoromethoxy substituent at the ortho position relative to the amino group. The trifluoromethoxy group imparts unique electronic properties, enhancing the compound's reactivity and influencing its solubility in various solvents. Typically, 2-Trifluoromethoxyaniline is a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its fluorinated structure can contribute to increased lipophilicity and potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of the amino group allows for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted, as fluorinated compounds can exhibit specific toxicological profiles.
Formula:C7H6F3NO
InChI:InChI=1S/C7H6F3NO/c8-7(9,10)12-6-4-2-1-3-5(6)11/h1-4H,11H2
InChI key:InChIKey=ZFCOUBUSGHLCDT-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(N)C=CC=C1
Synonyms:- (Pentafluorophenyl)(Phenyl)Methanone
- 2-(Trifluoromethoxy)benzenamine
- 2-(Trifluoromethyloxy)aniline
- 2-Trifluoromethoxyaniline
- 2-Trifluoromethoxyphenylamine
- Benzenamine, 2-(trifluoromethoxy)-
- o-(Trifluoromethoxy)aniline
- o-(Trifluoromethoxy)phenylamine
- o-Aminotrifluoromethoxybenzene
- o-Anisidine, α,α,α-trifluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-(Trifluoromethoxy)aniline
CAS:Formula:C7H6F3NOPurity:>98.0%(GC)Color and Shape:Colorless to Red to Green clear liquidMolecular weight:177.132-(Trifluoromethoxy)aniline
CAS:Formula:C7H6F3NOPurity:97%Color and Shape:LiquidMolecular weight:177.12382-(Trifluoromethoxy)aniline
CAS:2-(Trifluoromethoxy)anilineFormula:C7H6F3NOPurity:98%Color and Shape:Tan LiquidMolecular weight:177.123842-(Trifluoromethoxy)aniline
CAS:Formula:C7H6F3NOPurity:99.0%Color and Shape:Pale yellow liquidMolecular weight:177.1262-(Trifluoromethoxy)aniline
CAS:2-(Trifluoromethoxy)aniline is a heterocyclic aromatic compound that can act as an electrophilic catalyst. It is a strong nucleophile and reacts with various types of nucleophiles. 2-(Trifluoromethoxy)aniline has been used for the synthesis of aliphatic sulfoxides under acidic conditions, including alcohols, phenols, and thiols. The reaction mechanism is often a 1,2-addition of the nucleophile to the carbonyl group of 2-(trifluoromethoxy)aniline. This reaction is catalytic and produces a stable dimerized product. 2-(Trifluoromethoxy)aniline also has mesoporous properties, which allow it to be used in reactions involving alcohols or other polar molecules because they are soluble in the pores.Formula:C7H6F3NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:177.12 g/mol2-(Trifluoromethoxy)aniline
CAS:Controlled ProductStability Hygroscopic
Applications 2-(Trifluoromethoxy)aniline is a reactant used in the synthesis of GPBAR1 agonists which play a role in controlling inflammation.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Hogenauer, K., et. al.: J. Med. Chem., 57, 10343 (2014)Formula:C7H6F3NOColor and Shape:NeatMolecular weight:177.12







