CymitQuimica logo

CAS 153614-61-0

:

pentafluorobenzyl acrylate

Description:
Pentafluorobenzyl acrylate is an organic compound characterized by the presence of both an acrylate functional group and a pentafluorobenzyl moiety. Its molecular structure features a benzene ring substituted with five fluorine atoms, which significantly influences its chemical properties, including increased electronegativity and reactivity. The acrylate group contributes to its ability to undergo polymerization, making it useful in various applications such as coatings, adhesives, and as a monomer in the synthesis of fluorinated polymers. Pentafluorobenzyl acrylate is typically a colorless to pale yellow liquid with a low viscosity, and it exhibits a relatively low boiling point. Its high fluorine content imparts unique thermal and chemical stability, as well as hydrophobic characteristics. However, handling this compound requires caution due to its potential toxicity and reactivity, particularly in the presence of strong nucleophiles. Overall, pentafluorobenzyl acrylate is valued in materials science for its distinctive properties and versatility in polymer chemistry.
Formula:C10H5F5O2
InChI:InChI=1/C10H5F5O2/c1-2-5(16)17-3-4-6(11)8(13)10(15)9(14)7(4)12/h2H,1,3H2
SMILES:C=CC(=O)OCc1c(c(c(c(c1F)F)F)F)F
Synonyms:
  • Pentafluorobenzyl Prop-2-Enoate
Found 2 products.