CymitQuimica logo

CAS 15374-45-5

:

1,2-Bis(1-naphthyl)ethane

Description:
1,2-Bis(1-naphthyl)ethane, with the CAS number 15374-45-5, is an organic compound characterized by its structure, which consists of a central ethane unit bonded to two 1-naphthyl groups. This compound is a member of the class of bisaryl compounds and is notable for its potential applications in organic synthesis and materials science. It typically appears as a solid at room temperature and is insoluble in water but may dissolve in organic solvents such as benzene or toluene. The presence of naphthyl groups contributes to its aromatic character, which can influence its reactivity and stability. Additionally, 1,2-Bis(1-naphthyl)ethane can exhibit interesting electronic properties due to the conjugated system formed by the naphthyl rings, making it a subject of interest in studies related to organic electronics and photonics. Its synthesis often involves coupling reactions, and it may serve as a precursor or intermediate in the development of more complex organic molecules.
Formula:C22H18
InChI:InChI=1/C22H18/c1-3-13-21-17(7-1)9-5-11-19(21)15-16-20-12-6-10-18-8-2-4-14-22(18)20/h1-14H,15-16H2
InChI key:OJGSITVFPMSVGU-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)cccc2CCc1cccc2ccccc12
Synonyms:
  • 1,2-Di(alpha-naphthyl)ethane
  • 1,1'-Ethane-1,2-Diyldinaphthalene
Found 5 products.