CAS 153975-44-1

N-ethylpropan-2-amine hydrochloride

Description:

N-ethylpropan-2-amine hydrochloride, also known as N-ethyl-2-propanamine hydrochloride, is an organic compound characterized by its amine functional group. It is a derivative of propan-2-amine, where an ethyl group is substituted at the nitrogen atom. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. N-ethylpropan-2-amine hydrochloride is often used in pharmaceutical applications and research, particularly in the synthesis of various chemical intermediates and as a reagent in organic chemistry. Its properties include a relatively low molecular weight and a moderate boiling point, which are common for amines. Safety data indicates that, like many amines, it should be handled with care, as it may cause irritation to the skin, eyes, and respiratory system. Proper storage conditions are essential to maintain its stability and prevent degradation.

Formula: C₅H₁₄ClN

InChI: InChI=1/C5H13N.ClH/c1-4-6-5(2)3;/h5-6H,4H2,1-3H3;1H

SMILES: CCNC(C)C.Cl

N-(Ethyl-d5)propan-2-amine Hydrochloride

Controlled Product

CAS: 153975-44-1

Formula: C₅H₈D₅N

Color and Shape: Neat

Molecular weight: 128.65

Ref: TR-E749282