CAS 15423-57-1
:Germacrene B
Description:
Germacrene B is a naturally occurring sesquiterpene hydrocarbon, classified under the larger family of terpenes. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and biological activities. Germacrene B is typically found in various essential oils and plant extracts, particularly in species of the Asteraceae family. This compound is known for its distinctive aroma, often described as earthy or woody, making it of interest in the fragrance and flavor industries. Additionally, Germacrene B exhibits potential biological activities, including antimicrobial and insecticidal properties, which have garnered attention for its applications in agriculture and natural product chemistry. Its molecular formula reflects a specific arrangement of carbon and hydrogen atoms, contributing to its stability and reactivity. As with many terpenes, Germacrene B is also studied for its role in plant defense mechanisms and interactions with pollinators. Overall, Germacrene B is a significant compound in both ecological and industrial contexts.
Formula:C15H24
InChI:InChI=1/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9H,5,7-8,10-11H2,1-4H3/b13-6-,14-9-
InChI key:InChIKey=GXEGJTGWYVZSNR-SJRHNVSNSA-N
SMILES:CC(=C1CCC(=CCCC(=CC1)C)C)C
Synonyms:- (1E,5E)-1,5-Dimethyl-8-(1-methylethylidene)-1,5-cyclodecadiene
- (1E,5E)-1,5-dimethyl-8-(1-methylethylidene)cyclodeca-1,5-diene
- (1E,5E)-1,5-dimethyl-8-(propan-2-ylidene)cyclodeca-1,5-diene
- (1Z,5Z)-1,5-dimethyl-8-(1-methylethylidene)cyclodeca-1,5-diene
- (E,E)-Germacrene B
- 1,5-Cyclodecadiene, 1,5-dimethyl-8-(1-methylethylidene)-, (E,E)-
- 1,5-cyclodecadiene, 1,5-dimethyl-8-(1-methylethylidene)-, (1E,5E)-
- Germacra-1(10),4,7(11)-triene
- Germacra-1(10),4,7(11)-triene, (E,E)-
- Germacrene B
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Germacrene B
CAS:Germacrene B, a sesquiterpene identified in P. cablin (patchouli), demonstrates its presence within this botanical source.Formula:C15H24Color and Shape:SolidMolecular weight:204.35Germacrene B
CAS:Germacrene B is a sesquiterpene, which is a naturally occurring organic compound, typically sourced from essential oils of certain plants such as *Caryophyllaceae*. The compound belongs to the larger class of terpenoids and is characterized by its three isoprene units, forming a structure with biological activity.Formula:C15H24Purity:Min. 95%Molecular weight:204.35 g/mol




