CymitQuimica logo

CAS 154258-48-7

:

2-Propen-1-one, 1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-

Description:
2-Propen-1-one, 1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-, commonly referred to as a substituted α,β-unsaturated carbonyl compound, features a propenone backbone with a dimethylamino group and a chlorofluorophenyl substituent. This compound typically exhibits a yellow to brown color and is characterized by its reactivity due to the presence of the α,β-unsaturated carbonyl moiety, which can participate in various chemical reactions such as Michael additions and nucleophilic attacks. The dimethylamino group contributes to its basicity and potential as a nucleophile, while the chlorofluorophenyl group may influence its electronic properties and lipophilicity. This compound is of interest in organic synthesis and medicinal chemistry, potentially serving as a precursor or intermediate in the development of pharmaceuticals. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C11H11ClFNO
InChI:InChI=1S/C11H11ClFNO/c1-14(2)6-5-11(15)8-3-4-10(13)9(12)7-8/h3-7H,1-2H3
InChI key:InChIKey=ZOJGJDORYXDPEO-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC(Cl)=C(F)C=C1
Synonyms:
  • 1-(3-Chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one
  • 2-Propen-1-one, 1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-
Found 2 products.