CymitQuimica logo

CAS 154357-42-3

:

(S)-(-)-Nadifloxacin

Description:
(S)-(-)-Nadifloxacin is a synthetic fluoroquinolone antibiotic characterized by its chiral structure, which contributes to its biological activity. It is primarily used in the treatment of bacterial infections, particularly those caused by Gram-positive and Gram-negative organisms. The compound exhibits a broad spectrum of antibacterial activity, inhibiting bacterial DNA gyrase and topoisomerase IV, essential enzymes for bacterial DNA replication and transcription. Its stereochemistry, indicated by the (S)-(-) designation, plays a crucial role in its pharmacological properties, influencing its efficacy and safety profile. Nadifloxacin is typically administered topically, making it effective for skin infections, and it is known for its favorable pharmacokinetics, including good tissue penetration. Additionally, it has a relatively low potential for developing bacterial resistance compared to other antibiotics. As with many antibiotics, potential side effects may include gastrointestinal disturbances and allergic reactions, necessitating careful consideration during prescribing. Overall, (S)-(-)-Nadifloxacin represents a valuable option in the antibiotic arsenal, particularly for dermatological applications.
Formula:C19H21FN2O4
InChI:InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26)/t10-/m0/s1
InChI key:JYJTVFIEFKZWCJ-JTQLQIEISA-N
SMILES:C[C@H]1CCC2=C3N1C=C(C(=O)C3=CC(=C2N4CCC(CC4)O)F)C(=O)O
Synonyms:
  • 1H,5H-Benzo[ij]quinolizine-2-carboxylic acid, 9-fluoro-6,7-dihydro-8-(4-hydroxy-1-piperidinyl)-5-methyl-1-oxo-, (5S)- (9CI)
  • 1H,5H-Benzo[ij]quinolizine-2-carboxylic acid, 9-fluoro-6,7-dihydro-8-(4-hydroxy-1-piperidinyl)-5-methyl-1-oxo-, (S)-
  • Levonadifloxacin
Found 7 products.