CymitQuimica logo

CAS 15446-43-2

:

NEAMINE HYDROCHLORIDE

Description:
Neamine hydrochloride is a chemical compound that belongs to the class of aminoglycoside antibiotics. It is derived from neomycin and is characterized by its basic structure, which includes multiple amino groups that contribute to its biological activity. As a hydrochloride salt, it is typically presented as a white to off-white crystalline powder that is soluble in water, making it suitable for various pharmaceutical formulations. Neamine hydrochloride exhibits antibacterial properties, primarily effective against a range of Gram-negative and some Gram-positive bacteria, and is often used in research and clinical settings. Its mechanism of action involves inhibiting bacterial protein synthesis by binding to the 30S ribosomal subunit. Safety and handling precautions are essential due to its potential toxicity, particularly in high doses or prolonged exposure. As with many aminoglycosides, it may have side effects, including nephrotoxicity and ototoxicity, necessitating careful monitoring during therapeutic use. Overall, neamine hydrochloride is a significant compound in the field of microbiology and pharmacology.
Formula:C12H30Cl4N4O6
InChI:InChI=1S/C12H26N4O6.4ClH/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20;;;;/h3-12,17-20H,1-2,13-16H2;4*1H/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-;;;;/m1..../s1
InChI key:YHGAXELMYJIVJN-OXGCEHIISA-N
SMILES:C1[C@H]([C@@H]([C@H]([C@@H]([C@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CN)O)O)N)O)O)N.Cl.Cl.Cl.Cl
Found 8 products.