CymitQuimica logo

CAS 15448-76-7

:

DiMethyl bicyclo[2.2.1]heptane-1,4-carboxylate

Description:
DiMethyl bicyclo[2.2.1]heptane-1,4-carboxylate, with the CAS number 15448-76-7, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework. This compound features two methyl ester groups attached to the carboxylate functional group at the 1 and 4 positions of the bicyclic system. The presence of these functional groups contributes to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the ester groups, which can influence their interactions in various chemical environments. DiMethyl bicyclo[2.2.1]heptane-1,4-carboxylate may be utilized in organic synthesis and as an intermediate in the production of more complex molecules. Its structural characteristics may also impart unique physical properties, such as boiling and melting points, which are influenced by the steric and electronic effects of the bicyclic system and the ester groups. Overall, this compound is of interest in both academic research and potential industrial applications.
Formula:C11H16O4
InChI:InChI=1S/C11H16O4/c1-14-8(12)10-3-5-11(7-10,6-4-10)9(13)15-2/h3-7H2,1-2H3
InChI key:UBGSPDWVUMFEAZ-UHFFFAOYSA-N
SMILES:COC(=O)C12CCC(C1)(CC2)C(=O)OC
Synonyms:
  • Dimethyl (1r,4r)-bicyclo[2.2.1]heptane-1,4-dicarboxylate
Found 5 products.