CymitQuimica logo

CAS 15451-32-8

:

1-bromo-4-but-3-en-1-ylbenzene

Description:
1-Bromo-4-but-3-en-1-ylbenzene, with the CAS number 15451-32-8, is an organic compound characterized by the presence of a bromine atom attached to a benzene ring, which is further substituted with a but-3-en-1-yl group. This compound features a conjugated system due to the presence of the double bond in the but-3-en-1-yl moiety, which can influence its reactivity and stability. The bromine atom introduces a polar functional group, making the compound more reactive in nucleophilic substitution reactions. The structure suggests that it may exhibit both hydrophobic and hydrophilic characteristics, depending on the solvent used. Additionally, the presence of the alkene may allow for further reactions such as polymerization or addition reactions. The compound's physical properties, such as boiling point and solubility, would be influenced by the size and nature of the substituents on the benzene ring and the but-3-en-1-yl group. Overall, 1-bromo-4-but-3-en-1-ylbenzene is a versatile compound with potential applications in organic synthesis and materials science.
Formula:C10H11Br
InChI:InChI=1/C10H11Br/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8H,1,3-4H2
InChI key:QDNBBDYPPSSRTB-UHFFFAOYSA-N
SMILES:C=CCCc1ccc(cc1)Br
Found 3 products.