CAS 154607-00-8
:Benzoic acid, 2-bromo-5-hydroxy-, methyl ester
Description:
Benzoic acid, 2-bromo-5-hydroxy-, methyl ester, with the CAS number 154607-00-8, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a bromine atom and a hydroxyl group positioned on the aromatic ring, specifically at the 2 and 5 positions, respectively. The presence of these substituents influences its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents and limited solubility in water due to their hydrophobic aromatic structure. The hydroxyl group can participate in hydrogen bonding, which may enhance solubility in polar solvents. Additionally, the bromine atom can impart unique reactivity, making the compound useful in various synthetic applications, including as an intermediate in organic synthesis. Its potential applications may extend to pharmaceuticals, agrochemicals, or as a building block in the development of more complex molecules. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.
Formula:C8H7BrO3
InChI:InChI=1S/C8H7BrO3/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4,10H,1H3
InChI key:AIWIFVOBRBJANE-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=CC(=C1)O)Br
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Methyl 2-bromo-5-hydroxybenzoate
CAS:Methyl 2-bromo-5-hydroxybenzoateFormula:C8H7BrO3Purity:≥95%Color and Shape:SolidMolecular weight:231.04337Methyl 2-bromo-5-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.0434Ref: IN-DA00ABSR
250gTo inquire500gTo inquire100mg20.00€250mg24.00€1g37.00€5g73.00€10g116.00€25g182.00€50g257.00€100g425.00€Methyl 2-bromo-5-hydroxybenzoate
CAS:Methyl 2-bromo-5-hydroxybenzoateFormula:C8H7BrO3Purity:95%Molecular weight:231.04Methyl 2-bromo-5-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:95%Color and Shape:SolidMolecular weight:231.0452-Bromo-5-hydroxybenzoic acid methyl ester
CAS:2-Bromo-5-hydroxybenzoic acid methyl ester (2BB) is a phenoxy activator that activates the glucokinase activator. It has been shown to have a glucose lowering effect in both animal and human studies. 2BB is orally bioavailable and has an allosteric mode of action, which means it works by binding to the allosteric site on the enzyme's active site, thereby increasing its activity. It binds to the benzamide of glucokinase, which causes an increase in glucose uptake and utilization by cells. 2BB is being studied for use as an oral treatment for type II diabetes mellitus.Formula:C8H7BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:231.04 g/mol




