CAS 15469-97-3
:1-Trityl-1H-imidazole
Description:
1-Trityl-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The "trityl" group refers to a triphenylmethyl substituent, which significantly enhances the compound's stability and lipophilicity. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and chloroform, but it has limited solubility in water. 1-Trityl-1H-imidazole is often utilized in organic synthesis, particularly in the field of medicinal chemistry, due to its ability to act as a protecting group for various functional groups during chemical reactions. Its unique structure allows for diverse reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the presence of the trityl group can influence the electronic properties of the imidazole ring, potentially affecting its reactivity and interactions in biological systems. Overall, 1-Trityl-1H-imidazole is a versatile compound with significant applications in synthetic organic chemistry.
Formula:C22H18N2
InChI:InChI=1/C22H18N2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1ccnc1
Synonyms:- 1-Triphenylmethylimidazole
- 1-(Triphenylmethyl)imidazole
- 1-Tritylimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
1-Tritylimidazole, 98%
CAS:<p>It is a synthesis material intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a p</p>Formula:C22H18N2Purity:98%Molecular weight:310.4Trityl Imidazole (1-Trityl-1H-imidazole)
CAS:Compounds containing an unfused imidazole ring, whether or not hydrogenated, in the structure, nesoiFormula:C22H18N2Color and Shape:Off-White SolidMolecular weight:310.391-(Triphenylmethyl)imidazole
CAS:Formula:C22H18N2Purity:%Color and Shape:SolidMolecular weight:310.3917Clotrimazole EP Impurity F
CAS:Formula:C22H18N2Color and Shape:White To Off-White SolidMolecular weight:310.401-Trityl-1H-imidazole
CAS:<p>1-Trityl-1H-imidazole</p>Purity:98%Color and Shape:White PowderMolecular weight:310.39172g/mol1-Tritylimidazole
CAS:Formula:C22H18N2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:310.401-(Triphenylmethyl)-1H-imidazole (Deschloroclotrimazole)
CAS:Controlled ProductFormula:C22H18N2Color and Shape:NeatMolecular weight:310.39N-Tritylimidazole
CAS:<p>N-tritylimidazole is a palladium complex that was designed as an inhibitor of glycosidases. It binds to the active site of these enzymes and inhibits their function. N-tritylimidazole has been shown to inhibit the growth of Gram-positive bacteria, such as Staphylococcus aureus, by preventing the production of extracellular polysaccharides. This compound also binds to κ-opioid receptors in the brain and has been shown to block pain transmission. N-tritylimidazole can be synthesized using a cross-coupling reaction with phenylboronic acid and chloroiodomethane, which requires hydrochloric acid as a catalyst.</p>Formula:C22H18N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:310.39 g/mol1-Trityl-1H-imidazole
CAS:<p>1-Trityl-1H-imidazole is a useful organic compound for research related to life sciences. The catalog number is T66710 and the CAS number is 15469-97-3.</p>Formula:C22H18N2Color and Shape:SolidMolecular weight:310.4











