CAS 1551078-43-3

L-Cysteine, S-[1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]-

Description:

L-Cysteine, S-[1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]- is a synthetic derivative of the naturally occurring amino acid L-cysteine, characterized by the presence of a nitro-substituted benzodioxole moiety. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the presence of the thiol (-SH) group from cysteine. The nitro group may impart additional reactivity and influence the compound's biological activity, potentially enhancing its role as a precursor in various biochemical pathways or as a pharmacological agent. The presence of the benzodioxole structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antioxidant or neuroprotective properties. As with many derivatives, the specific characteristics such as melting point, boiling point, and reactivity would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling precautions should be observed due to the presence of the nitro group, which can be associated with explosive properties under certain conditions.

Formula: C₁₂H₁₄N₂O₆S

InChI: InChI=1S/C12H14N2O6S/c1-6(21-4-8(13)12(15)16)7-2-10-11(20-5-19-10)3-9(7)14(17)18/h2-3,6,8H,4-5,13H2,1H3,(H,15,16)/t6?,8-/m0/s1

InChI key: PEXWLXHWCRAGLS-XDKWHASVSA-N

SMILES: CC(C1=CC2=C(C=C1[N+](=O)[O-])OCO2)SC[C@@H](C(=O)O)N

Synonyms:

• (2R)-2-Amino-3-((1-(6-nitrobenzo[d][1,3]dioxol-5 -yl)ethyl)thio)propanoic acid
• L-Cysteine, S-[1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]-

CTCE 9908 acetate

CAS: 1551078-43-3

CTCE 9908 acetate

Formula: C₈₈H₁₅₁N₂₇O₂₅

Purity: ≥98%

Molecular weight: 1987.31

Ref: 54-BUP20445

H-L-Cys(MDNPE)-OH

CAS: 1551078-43-3

H-L-Cys(MDNPE)-OH (compound 2) is a genetically encoded photocaged cysteine compound designed to activate TEV protease activity in mammalian cells upon illumination.

Formula: C₁₂H₁₄N₂O₆S

Color and Shape: Solid

Molecular weight: 314.31

Ref: TM-TP2899

H-Cys(MDNPE)

CAS: 1551078-43-3

Formula: C₁₂H₁₄N₂O₆S

Purity: 98%

Molecular weight: 314.3144

Ref: IN-DA0HZRA0

H-L-Cys(mdnpe)-OH

CAS: 1551078-43-3

A novel protected cysteine that can be cleaved by photolysis.

Formula: C₁₂H₁₄N₂O₆S

Purity: Min. 95%

Molecular weight: 314.32 g/mol

Ref: 3D-BMC07843