CAS 155233-31-1
:Benzenepropanamide,N-[(1S)-2-methyl-1-[[(3R,4S)-4-methyl-2,5-dioxo-3-pyrrolidinyl]carbonyl]propyl]-b-[[(2E,4E)-1-oxo-2,4-hexadien-1-yl]amino]-,(bS)-
Description:
Benzenepropanamide, N-[(1S)-2-methyl-1-[[(3R,4S)-4-methyl-2,5-dioxo-3-pyrrolidinyl]carbonyl]propyl]-b-[[(2E,4E)-1-oxo-2,4-hexadien-1-yl]amino]-, (bS)-, with CAS number 155233-31-1, is a complex organic compound characterized by its multi-functional structure that includes amide, carbonyl, and diene groups. This compound features a chiral center, indicating potential stereoisomerism, which can influence its biological activity and interactions. The presence of the pyrrolidine ring contributes to its cyclic structure, while the benzene moiety provides aromatic characteristics, enhancing its stability and reactivity. The compound's molecular architecture suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. Its solubility, stability, and reactivity would depend on the specific functional groups and their spatial arrangement, which can affect its pharmacokinetic properties. Overall, this compound exemplifies the complexity often found in bioactive molecules, making it a subject of interest in chemical and pharmaceutical research.
Formula:C25H31N3O5
InChI:InChI=1S/C25H31N3O5/c1-5-6-8-13-19(29)26-18(17-11-9-7-10-12-17)14-20(30)27-22(15(2)3)23(31)21-16(4)24(32)28-25(21)33/h5-13,15-16,18,21-22H,14H2,1-4H3,(H,26,29)(H,27,30)(H,28,32,33)/b6-5+,13-8+/t16-,18-,21+,22-/m0/s1
InChI key:WMLLJSBRSSYYPT-PQUJRENYSA-N
SMILES:C/C=C/C=C/C(=O)N[C@@H](CC(=O)N[C@@H](C(C)C)C(=O)[C@H]1[C@@H](C(=O)NC1=O)C)C2=CC=CC=C2
Synonyms:- Benzenepropanamide,N-[(1S)-2-methyl-1-[[(3R,4S)-4-methyl-2,5-dioxo-3-pyrrolidinyl]carbonyl]propyl]-b-[[(2E,4E)-1-oxo-2,4-hexadienyl]amino]-,(bS)- (9CI)
- Benzenepropanamide,N-[2-methyl-1-[(4-methyl-2,5-dioxo-3-pyrrolidinyl)carbonyl]propyl]-b-[(1-oxo-2,4-hexadienyl)amino]-,[3R-[3a[S*[S*(E,E)]],4b]]-
- Moiramide B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Moiramide B
CAS:Moiramide B is an acetyl coenzyme A carboxylase inhibitor with antimicrobial activity, strongly inhibiting Gram-positive bacteria.Formula:C25H31N3O5Purity:98.53% - 99.78%Color and Shape:SolidMolecular weight:453.53Moiramide B
CAS:Moiramide B is an analog of the protein kinase inhibitor indirubin. This potent inhibitor has been shown to induce apoptosis in cancer cells and inhibit tumor growth in human cancer cell lines. Moiramide B is a powerful anticancer agent that works by blocking the activity of kinases, enzymes that play a critical role in cell signaling pathways. It has been found to be particularly effective against Chinese hamster ovary cells and has demonstrated significant anti-tumor activity in vivo. Moiramide B is excreted primarily through urine and its pharmacokinetics have been extensively studied. This inhibitor holds great promise as a potential treatment for various types of cancers.Formula:C25H31N3O5Purity:Min. 95%Molecular weight:453.5 g/molRef: 3D-FGA23331
Discontinued product







