CymitQuimica logo

CAS 15540-82-6

:

2,3-Dibromo-1,4-dimethyl-5-nitrobenzene

Description:
2,3-Dibromo-1,4-dimethyl-5-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, two methyl groups, and a nitro group. The presence of the bromine atoms introduces significant electrophilic character, making the compound reactive in various chemical reactions. The nitro group, known for its electron-withdrawing properties, enhances the compound's acidity and influences its reactivity, particularly in electrophilic aromatic substitution reactions. The methyl groups serve as electron-donating substituents, which can stabilize the aromatic system. This compound is typically used in organic synthesis and may serve as an intermediate in the production of other chemical entities. Its physical properties, such as melting point and solubility, are influenced by the presence of the substituents, which can affect intermolecular interactions. Safety precautions should be taken when handling this compound, as brominated and nitro-substituted compounds can pose health risks and environmental concerns.
Formula:C8H7Br2NO2
InChI:InChI=1S/C8H7Br2NO2/c1-4-3-6(11(12)13)5(2)8(10)7(4)9/h3H,1-2H3
InChI key:InChIKey=NUFRALZMBQQGAM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(Br)=C(Br)C(C)=C1
Synonyms:
  • 2,3-Dibromo-1,4-dimethyl-5-nitrobenzene
  • p-Xylene, 2,3-dibromo-5-nitro-
  • Benzene, 2,3-dibromo-1,4-dimethyl-5-nitro-
Found 4 products.