CAS 15544-52-2

3,4-Dihydro-2,5,8(1H)-quinolinetrione

Description:

3,4-Dihydro-2,5,8(1H)-quinolinetrione, with the CAS number 15544-52-2, is a heterocyclic organic compound characterized by its quinoline structure, which features a fused ring system containing nitrogen atoms. This compound typically exhibits a trione functional group, indicating the presence of three carbonyl (C=O) groups within its molecular framework. The presence of these functional groups often imparts significant reactivity, making it a potential candidate for various chemical transformations. In terms of physical properties, compounds of this class may exhibit moderate solubility in polar solvents due to the presence of the carbonyl groups, while their aromatic nature can contribute to stability and unique electronic properties. Additionally, 3,4-Dihydro-2,5,8(1H)-quinolinetrione may demonstrate biological activity, which could be of interest in medicinal chemistry. Its synthesis and applications could be explored in the context of drug development or as intermediates in organic synthesis. However, specific reactivity and stability would depend on the conditions under which it is handled.

Formula: C₉H₇NO₃

InChI: InChI=1S/C9H7NO3/c11-6-2-3-7(12)9-5(6)1-4-8(13)10-9/h2-3H,1,4H2,(H,10,13)

InChI key: InChIKey=KBQJDQNCORENFW-UHFFFAOYSA-N

SMILES: O=C1C2=C(C(=O)C=C1)CCC(=O)N2

Synonyms:

• 2,5,8(1H)-Quinolinetrione, 3,4-dihydro-
• 3,4-Dihydro-2,5,8(1H)-quinolinetrione
• NSC 109349
• 1,2,3,4,5,8-Hexahydroquinoline-2,5,8-trione
• 3,4-Dihydro-1H-quinoline-2,5,8-trione

2,5,8(1H)-Quinolinetrione, 3,4-dihydro-

CAS: 15544-52-2

Formula: C₉H₇NO₃

Molecular weight: 177.1568

Ref: IN-DA001NXH