CAS 155445-31-1

Methyl 1H-benzofuro[3,2-b]pyrrole-2-carboxylate

Description:

Methyl 1H-benzofuro[3,2-b]pyrrole-2-carboxylate is a chemical compound characterized by its complex fused ring structure, which includes a benzofuro and pyrrole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and unique reactivity due to the presence of multiple functional groups. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. The methyl ester functional group contributes to its solubility and reactivity, making it a versatile intermediate in organic synthesis. Additionally, compounds of this nature may exhibit fluorescence, which can be useful in various analytical applications. As with many organic compounds, safety and handling precautions are essential, as they may pose health risks or environmental hazards. Overall, Methyl 1H-benzofuro[3,2-b]pyrrole-2-carboxylate represents a significant interest in both academic and industrial research settings.

Formula: C₁₂H₉NO₃

InChI: InChI=1S/C12H9NO3/c1-15-12(14)8-6-10-11(13-8)7-4-2-3-5-9(7)16-10/h2-6,13H,1H3

InChI key: InChIKey=AOWSNWURKKOALC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2C=3C(OC2C1)=CC=CC3

Synonyms:

• 1H-Benzofuro[3,2-b]pyrrole-2-carboxylic acid, methyl ester
• Methyl 1H-benzofuro[3,2-b]pyrrole-2-carboxylate

1H-Benzofuro[3,2-b]pyrrole-2-carboxylic acid, methyl ester

CAS: 155445-31-1

Formula: C₁₂H₉NO₃

Molecular weight: 215.2048

Ref: IN-DA001NX1