CymitQuimica logo

CAS 15548-56-8

:

4-Cyclopentene-1,2,3-trione

Description:
4-Cyclopentene-1,2,3-trione, with the CAS number 15548-56-8, is an organic compound characterized by its unique cyclic structure and the presence of three carbonyl groups. This compound features a cyclopentene ring, which is a five-membered carbon ring containing one double bond, and is substituted with three ketone functional groups at the 1, 2, and 3 positions. The presence of these carbonyl groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The compound is typically a yellow to orange solid and is soluble in polar organic solvents. Its reactivity and structural features make it of interest in synthetic organic chemistry, particularly in the development of more complex molecules. Additionally, the compound may exhibit interesting properties such as fluorescence or photochemical behavior, which can be explored in various applications, including materials science and organic synthesis. However, specific handling precautions should be observed due to its potential reactivity.
Formula:C5H2O3
InChI:InChI=1S/C5H2O3/c6-3-1-2-4(7)5(3)8/h1-2H
InChI key:InChIKey=GSGMKOPCDJFHEF-UHFFFAOYSA-N
SMILES:O=C1C(=O)C=CC1=O
Synonyms:
  • Cyclopentene-1,2,3-trione
  • 4-Cyclopentene-1,2,3-trione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.