CymitQuimica logo

CAS 1555-17-5

:

1-Fluoropentadecane

Description:
1-Fluoropentadecane is a fluorinated alkane with the molecular formula C15H31F. It is characterized by a long hydrocarbon chain consisting of 15 carbon atoms, with a fluorine atom substituting one of the hydrogen atoms. This substitution imparts unique properties to the molecule, such as increased hydrophobicity and altered reactivity compared to its non-fluorinated counterparts. 1-Fluoropentadecane is typically a colorless liquid at room temperature and exhibits low volatility and low solubility in water, making it more soluble in organic solvents. Its fluorine content contributes to thermal and chemical stability, which can be advantageous in various applications, including as a surfactant or in specialty chemical formulations. Additionally, the presence of the fluorine atom can enhance the compound's resistance to degradation, making it useful in environments where chemical stability is crucial. However, the environmental impact and potential toxicity of fluorinated compounds are important considerations in their use and disposal.
Formula:C15H31F
InChI:InChI=1S/C15H31F/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16/h2-15H2,1H3
InChI key:InChIKey=DRKDLVHRJPXHJU-UHFFFAOYSA-N
SMILES:C(CCCCCCCF)CCCCCCC
Synonyms:
  • 1-Fluoropentadecane
  • Pentadecane, 1-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.