
CAS 1555-72-2
:N1-(3-Aminopropyl)-N1-phenyl-1,3-propanediamine
Description:
N1-(3-Aminopropyl)-N1-phenyl-1,3-propanediamine, also known by its CAS number 1555-72-2, is an organic compound characterized by its structure, which includes a phenyl group and a propylamine chain. This compound features two amine functional groups, making it a diamine. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of amine groups contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as alkylation and acylation. It is soluble in polar solvents, which enhances its utility in organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Additionally, due to its amine functionality, it may exhibit biological activity, making it of interest in medicinal chemistry. However, safety precautions should be taken when handling this compound, as amines can be irritants and may pose health risks.
Formula:C12H21N3
InChI:InChI=1S/C12H21N3/c13-8-4-10-15(11-5-9-14)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11,13-14H2
InChI key:InChIKey=FCYLESXZIMNFSO-UHFFFAOYSA-N
SMILES:N(CCCN)(CCCN)C1=CC=CC=C1
Synonyms:- 1,3-Propanediamine, N1-(3-aminopropyl)-N1-phenyl-
- N1-(3-Aminopropyl)-N1-phenyl-1,3-propanediamine
- 1,3-Propanediamine, N-(3-aminopropyl)-N-phenyl-
- Aniline, N,N-bis(3-aminopropyl)-
- Benzenamine, N,N-bis(3-aminopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
