CAS 155521-46-3
:Alisol G
Description:
Alisol G, with the CAS number 155521-46-3, is a chemical compound derived from the natural product alisol, which is found in the rhizomes of certain plants, particularly those in the genus Alisma. This compound is characterized by its triterpenoid structure, which contributes to its biological activity. Alisol G exhibits various pharmacological properties, including anti-inflammatory and hepatoprotective effects, making it of interest in medicinal chemistry and herbal medicine. It is often studied for its potential therapeutic applications, particularly in the treatment of liver diseases and metabolic disorders. The compound is typically analyzed using techniques such as chromatography and spectroscopy to determine its purity and structural characteristics. Additionally, Alisol G's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in its application and formulation in pharmaceutical products. Overall, Alisol G represents a significant area of research in the field of natural products and their potential health benefits.
Formula:C30H48O4
InChI:InChI=1S/C30H48O4/c1-17(2)25(34)21(31)15-18(3)19-9-13-29(7)20(19)16-22(32)26-28(6)12-11-24(33)27(4,5)23(28)10-14-30(26,29)8/h18,21-23,25-26,31-32,34H,1,9-16H2,2-8H3/t18-,21+,22+,23+,25+,26+,28+,29+,30+/m1/s1
InChI key:InChIKey=WLNDANGOFVYODW-XCXJHVMUSA-N
SMILES:C[C@@]12[C@]([C@]3(C)[C@@](CC1)(C(C)(C)C(=O)CC3)[H])([C@@H](O)CC=4[C@]2(C)CCC4[C@@H](C[C@@H]([C@H](C(C)=C)O)O)C)[H]
Synonyms:- (8α,9β,11β,14β,23S,24S)-11,23,24-Trihydroxydammara-13(17),25-dien-3-one
- 25-Anhydroalisol A
- 25-AnhydroalisolA
- Alisol G
- Dammara-13(17),25-dien-3-one, 11,23,24-trihydroxy-, (8α,9β,11β,14β,23S,24S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dammara-13(17),25-dien-3-one, 11,23,24-trihydroxy-, (8α,9β,11β,14β,23S,24S)-
CAS:Formula:C30H48O4Purity:98%Molecular weight:472.6997Alisol G
CAS:Alisol G (25-Anhydroalisol A) is isolated from Rhizoma Alismatis and exhibits hCE2 inhibitory effects.Formula:C30H48O4Purity:98.17%Color and Shape:SolidMolecular weight:472.7Alisol G
CAS:Controlled ProductAlisol G is a drug that has been shown to promote kidney growth in animal experiments and has the potential to slow down the progression of chronic kidney disease. Alisol G is a mixture of acetate extract, which contains alisol, and growth factor-β1. The chemical compositions of alisol are unknown but it may be an alkaloid or phenol. It was found to increase intracellular calcium concentrations and reduce the density lipoprotein levels in cancer cells. Alisol G also increased cell proliferation and migration rates of MDA-MB-231 breast cancer cells in vitro.Formula:C30H48O4Purity:Min. 95%Molecular weight:472.7 g/mol





