CAS 1556-01-0
:2-(2,4-Dichloro-5-methylphenoxy)acetic acid
Description:
2-(2,4-Dichloro-5-methylphenoxy)acetic acid, commonly known as dicamba, is a selective herbicide used primarily for controlling broadleaf weeds in various crops. It is characterized by its phenoxyacetic acid structure, which contributes to its herbicidal activity. The compound features two chlorine atoms and a methyl group on the aromatic ring, enhancing its effectiveness against specific weed species. Dicamba is typically applied post-emergence, allowing it to target weeds without harming most grass crops. It acts by mimicking natural plant hormones, leading to uncontrolled growth and eventual plant death. The substance is moderately soluble in water and has a relatively low volatility, which helps reduce the risk of drift during application. However, it is important to note that dicamba has been associated with off-target effects, leading to damage in sensitive crops, prompting regulatory scrutiny and the development of formulations designed to minimize such risks. Proper application techniques and adherence to guidelines are essential for effective and responsible use of this herbicide.
Formula:C9H8Cl2O3
InChI:InChI=1S/C9H8Cl2O3/c1-5-2-8(14-4-9(12)13)7(11)3-6(5)10/h2-3H,4H2,1H3,(H,12,13)
InChI key:InChIKey=JIPVYKRMJQZZLF-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(Cl)C=C(Cl)C(C)=C1
Synonyms:- 2,4-Dichloro-5-methylphenoxyacetic acid
- Acetic acid, [(4,6-dichloro-m-tolyl)oxy]-
- 2-(2,4-Dichloro-5-methylphenoxy)acetic acid
- Acetic acid, (2,4-dichloro-5-methylphenoxy)-
- Acetic acid, 2-(2,4-dichloro-5-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
