CAS 15560-65-3
:2-(4-butoxy-3-fluorophenyl)-N-hydroxyacetamide
Description:
2-(4-butoxy-3-fluorophenyl)-N-hydroxyacetamide, with the CAS number 15560-65-3, is a chemical compound characterized by its specific functional groups and structural features. It contains a hydroxylamine moiety, which is indicative of its potential reactivity and biological activity. The presence of a butoxy group suggests hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The fluorine atom in the phenyl ring can enhance the compound's lipophilicity and may also affect its electronic properties, potentially impacting its reactivity and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity allows for potential interactions with biological targets, which could be explored in drug development. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H16FNO3
InChI:InChI=1/C12H16FNO3/c1-2-3-6-17-11-5-4-9(7-10(11)13)8-12(15)14-16/h4-5,7,16H,2-3,6,8H2,1H3,(H,14,15)
SMILES:CCCCOc1ccc(cc1F)CC(=NO)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
