CAS 155601-17-5
:4,5-Diamino-1-(2-hydroxyethyl)pyrazole
Description:
4,5-Diamino-1-(2-hydroxyethyl)pyrazole, with the CAS number 155601-17-5, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features two amino groups (-NH2) at the 4 and 5 positions of the pyrazole ring, contributing to its potential reactivity and ability to form hydrogen bonds. The presence of a hydroxyethyl group at the 1 position enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry and agricultural applications, particularly as intermediates in the synthesis of pharmaceuticals or agrochemicals. The amino groups can participate in various chemical reactions, including acylation and alkylation, making this compound versatile in synthetic pathways. Additionally, its structural features may impart specific biological activities, warranting further investigation into its pharmacological properties. Overall, 4,5-Diamino-1-(2-hydroxyethyl)pyrazole is a compound with significant potential for various applications in chemistry and biology.
Formula:C5H10N4O
InChI:InChI=1S/C5H10N4O/c6-4-3-8-9(1-2-10)5(4)7/h3,10H,1-2,6-7H2
InChI key:InChIKey=KDBUTNSQYYLYOY-UHFFFAOYSA-N
SMILES:C(CO)N1C(N)=C(N)C=N1
Synonyms:- 1-(2-Hydroxyethyl)-4,5-diaminopyrazole
- 1H-Pyrazole-1-ethanol, 4,5-diamino-
- 2-(4,5-Diamino-1H-pyrazol-1-yl)ethan-1-ol
- 2-(4,5-Diamino-1H-pyrazol-1-yl)ethanol
- 4,5-Diamino-1-(2-hydroxyethyl)-1H-pyrazol
- 4,5-Diamino-1-(2-hydroxyethyl)-1H-pyrazole
- 4,5-Diamino-1H-pyrazole-1-ethanol
- 4,5-Diamino-1-(2-hydroxyethyl)pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
