CAS 155622-69-8
:1-Bromobut-3-en-2-one
Description:
1-Bromobut-3-en-2-one, with the CAS number 155622-69-8, is an organic compound characterized by its structure, which includes a bromine atom, a double bond, and a ketone functional group. This compound features a four-carbon chain with a double bond between the second and third carbons and a ketone group at the second carbon. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is polar due to the carbonyl group, which influences its solubility in various solvents. Its reactivity is enhanced by the presence of both the double bond and the electrophilic nature of the carbonyl, allowing it to participate in various chemical reactions, such as nucleophilic additions and substitutions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system.
Formula:C4H5BrO
InChI:InChI=1/C4H5BrO/c1-2-4(6)3-5/h2H,1,3H2
SMILES:C=CC(=O)CBr
Synonyms:- 3-Buten-2-One, 1-Bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
