CymitQuimica logo

CAS 155629-97-3

:

2-Methylpyrido[2,3-b]pyrazine

Description:
2-Methylpyrido[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused ring structure, which includes both pyridine and pyrazine moieties. This compound features a methyl group attached to the pyridine ring, influencing its chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of nitrogen atoms in its structure contributes to its basicity and potential for forming coordination complexes with metals. 2-Methylpyrido[2,3-b]pyrazine is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various applications. However, as with many nitrogen-containing heterocycles, it may exhibit specific toxicity or environmental concerns, necessitating careful handling and assessment in laboratory settings.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c1-6-5-10-8-7(11-6)3-2-4-9-8/h2-5H,1H3
InChI key:InChIKey=OPYWACMELIMCPE-UHFFFAOYSA-N
SMILES:CC1=NC2=C(N=C1)N=CC=C2
Synonyms:
  • Pyrido[2,3-b]pyrazine, 2-methyl-
  • 2-Methylpyrido[2,3-b]pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.