CAS 15568-88-4
:5-(AMINOMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE
Description:
5-(Aminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, with the CAS number 15568-88-4, is a chemical compound characterized by its unique structural features, including a dioxane ring and an aminomethylene group. This compound typically exhibits properties associated with both amines and diketones, which can influence its reactivity and potential applications in organic synthesis. The presence of the dimethyl groups contributes to its steric hindrance, potentially affecting its interaction with other molecules. As a diketone, it may participate in various chemical reactions, such as condensation or nucleophilic addition. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Additionally, its biological activity may be of interest in medicinal chemistry, although specific biological properties would require further investigation. Overall, this compound represents a versatile structure that could be explored for various synthetic and pharmaceutical applications.
Formula:C7H9NO4
InChI:InChI=1/C7H9NO4/c1-7(2)11-5(9)4(3-8)6(10)12-7/h3-4,8H,1-2H3/b8-3+
Synonyms:- 5-(Aminomethylidene)-2,2-Dimethyl-1,3-Dioxane-4,6-Dione
- 5-[(E)-iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Aminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione
CAS:Formula:C7H9NO4Color and Shape:SolidMolecular weight:171.1507
