
CAS 15568-92-0
:2,2-Dimethyl-5-[(phenylamino)methylene]-1,3-dioxane-4,6-dione
Description:
2,2-Dimethyl-5-[(phenylamino)methylene]-1,3-dioxane-4,6-dione, with CAS number 15568-92-0, is a synthetic organic compound characterized by its unique structural features, including a dioxane ring and a phenylamino substituent. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the dioxane moiety contributes to its potential reactivity, particularly in nucleophilic addition reactions. The phenylamino group enhances its ability to participate in various chemical transformations, making it of interest in medicinal chemistry and organic synthesis. Additionally, the compound may display biological activity, which could be explored for pharmaceutical applications. Its stability under standard conditions is generally good, although specific handling precautions should be observed due to potential reactivity. Overall, 2,2-Dimethyl-5-[(phenylamino)methylene]-1,3-dioxane-4,6-dione represents a versatile structure with implications in both research and application within the field of organic chemistry.
Formula:C13H13NO4
InChI:InChI=1S/C13H13NO4/c1-13(2)17-11(15)10(12(16)18-13)8-14-9-6-4-3-5-7-9/h3-8,14H,1-2H3
InChI key:InChIKey=GTAWFIKDUIDKEP-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)=C2C(=O)OC(C)(C)OC2=O
Synonyms:- 2,2-Propanediol, cyclic (anilinomethylene)malonate
- 2,2-Dimethyl-5-[(phenylamino)methylene]-1,3-dioxane-4,6-dione
- Malonic acid, (anilinomethylene)-, cyclic isopropylidene ester
- 1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[(phenylamino)methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[(phenylamino)methylene]-
CAS:Formula:C13H13NO4Molecular weight:247.2466
