CymitQuimica logo

CAS 15571-59-2

:

4,9,11-Trioxa-10-stannapentadeca-6,13-dien-15-oic acid, 2-methyl-10,10-dioctyl-5,8,12-trioxo-, 2-methylpropyl ester, (Z,Z)-

Description:
4,9,11-Trioxa-10-stannapentadeca-6,13-dien-15-oic acid, 2-methyl-10,10-dioctyl-5,8,12-trioxo-, 2-methylpropyl ester, commonly referred to by its CAS number 15571-59-2, is a complex organotin compound characterized by its unique structure that includes multiple oxygen and tin atoms. This compound features a long carbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the trioxo functional groups indicates potential reactivity, particularly in coordination chemistry and polymer applications. The organotin moiety suggests potential uses in various industrial applications, including as a stabilizer or catalyst in polymer production. Additionally, the compound's ester functionality may impart characteristics such as improved thermal stability and compatibility with other materials. However, due to the presence of tin, it is essential to consider environmental and health regulations associated with organotin compounds, as they can exhibit toxicity and bioaccumulation potential. Overall, this compound's unique structural features make it of interest in both research and industrial contexts.
Formula:C32H56O8Sn
InChI:InChI=1S/2C8H12O4.2C8H17.Sn/c2*1-6(2)5-12-8(11)4-3-7(9)10;2*1-3-5-7-8-6-4-2;/h2*3-4,6H,5H2,1-2H3,(H,9,10);2*1,3-8H2,2H3;/q;;;;+2/p-2/b2*4-3-;;;
InChI key:InChIKey=LHLONJLCNOUWLO-VGKOASNMSA-L
SMILES:[Sn](OC(/C=C\C(OCC(C)C)=O)=O)(OC(/C=C\C(OCC(C)C)=O)=O)(CCCCCCCC)CCCCCCCC
Synonyms:
  • Maleic acid, monoisobutyl ester, dioctylstannylene deriv.
  • 4,9,11-Trioxa-10-stannapentadeca-6,13-dien-15-oic acid, 2-methyl-10,10-dioctyl-5,8,12-trioxo-, 2-methylpropyl ester, (Z,Z)-
  • Monooctyl dioctyltin maleate
  • Stannane, bis[(3-carboxyacryloyl)oxy]dioctyl-, diisobutyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.