CAS 15571-60-5
:(2Z,2′Z)-4,4′-[(Dioctylstannylene)bis(oxy)]bis[4-oxo-2-butenoic acid]
Description:
The chemical substance known as (2Z,2′Z)-4,4′-[(Dioctylstannylene)bis(oxy)]bis[4-oxo-2-butenoic acid], with the CAS number 15571-60-5, is a complex organotin compound characterized by its unique structure that includes dioctylstannylene groups and multiple functional groups. This compound typically exhibits properties associated with organotin derivatives, such as potential applications in polymer chemistry and as a stabilizer or catalyst in various reactions. The presence of the 4-oxo-2-butenoic acid moiety suggests that it may have acidic properties and could participate in various chemical reactions, including esterification or polymerization. Additionally, the dioctylstannylene component may impart hydrophobic characteristics, influencing its solubility and interaction with other substances. Overall, this compound's specific characteristics, including its reactivity and stability, would depend on its molecular structure and the conditions under which it is used. Safety and environmental considerations are also crucial, as organotin compounds can exhibit toxicity and bioaccumulation potential.
Formula:C24H40O8Sn
InChI:InChI=1/2C8H17.2C4H4O4.Sn/c2*1-3-5-7-8-6-4-2;2*5-3(6)1-2-4(7)8;/h2*1,3-8H2,2H3;2*1-2H,(H,5,6)(H,7,8);/b;;2*2-1-;/rC16H34Sn.2C4H4O4/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;2*5-3(6)1-2-4(7)8/h3-16H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1-
InChI key:InChIKey=WNEDOMBPJDUQPS-BFIADXHOSA-L
SMILES:[Sn](OC(/C=C\C(O)=O)=O)(OC(/C=C\C(O)=O)=O)(CCCCCCCC)CCCCCCCC
Synonyms:- Diisobutylmaleate dioctyltin
- 4,4'-((Dioctylstannylene)bis(oxy))bis(4-oxoisocrotonic)acid
- Dioctyltinbis(maleate)
- 2-Butenoic acid, 4,4′-[(dioctylstannylene)bis(oxy)]bis[4-oxo-, (Z,Z)-
- (Z,Z)-4,4'-((Dioctylstannylene)bis(oxy))bis(4-oxo-2-butenoic acid)
- 2-Butenoic acid, 4,4′-[(dioctylstannylene)bis(oxy)]bis[4-oxo-, (2Z,2′Z)-
- (2Z,2′Z)-4,4′-[(Dioctylstannylene)bis(oxy)]bis[4-oxo-2-butenoic acid]
- Dioctyltinbis(maleate)
- dioctyl-lambda~2~-stannane - (2Z)-but-2-enedioic acid (1:2)
- Diisobutylmaleate dioctyltin
- 2-Butenoic acid, 4,4'-((dioctylstannylene)bis(oxy))bis(4-oxo-, (Z,Z)-
- Einecs 239-625-0
- DI-N-OCTYLTINDIMALEATE
- 4,4'-[(Dioctylstannanediyl)bisoxy]bis(4-oxoisocrotonic acid)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dioctyltinbis(maleate)
CAS:Controlled ProductFormula:C16H34Sn·2C4H3O4Color and Shape:NeatMolecular weight:575.28
