CAS 15572-79-9: L-Galactose
Description:L-Galactose is a monosaccharide, specifically an aldohexose, that plays a crucial role in various biological processes. It is a stereoisomer of glucose and is characterized by its six-carbon structure, with a hydroxyl group (-OH) attached to each carbon except for the aldehyde group at one end. L-Galactose is typically found in nature as part of larger carbohydrates, such as lactose, and is important in cellular metabolism and energy production. It is a white, crystalline solid that is soluble in water, exhibiting a sweet taste. The molecule can exist in both open-chain and cyclic forms, with the cyclic form being more prevalent in solution. L-Galactose is also involved in the synthesis of glycoproteins and glycolipids, which are essential for cell recognition and signaling. Its CAS number, 15572-79-9, is used for identification in chemical databases. Overall, L-Galactose is significant in nutrition and biochemistry, contributing to various metabolic pathways and cellular functions.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m1/s1
InChI key:InChIKey=GZCGUPFRVQAUEE-DPYQTVNSSA-N
SMILES:O=CC(O)C(O)C(O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">L</span>-Galactose
- Einecs 239-630-8
- Galactose, <span class="text-smallcaps">L</span>-
- L-galactopyranose
- alpha-L-galactopyranose
- beta-L-galactopyranose
- Galactose, L-
- L-Galactose
