CAS 15573-31-6
:n-Propyldichlorophosphine
Description:
n-Propyldichlorophosphine is an organophosphorus compound characterized by its phosphorus atom bonded to two chlorine atoms and a propyl group. It is typically a colorless to yellowish liquid with a pungent odor, indicative of its reactivity and potential toxicity. This compound is known for its role as an intermediate in the synthesis of various phosphorus-containing chemicals, including pesticides and flame retardants. n-Propyldichlorophosphine is highly reactive, particularly with water, leading to the release of hydrochloric acid and the formation of phosphine oxides or other derivatives. Due to its reactivity, it requires careful handling and storage under inert conditions to prevent hydrolysis and degradation. The compound is classified as hazardous, necessitating appropriate safety measures during use, including personal protective equipment and proper ventilation. Its applications in organic synthesis and chemical manufacturing highlight its significance in the field of chemistry, particularly in the development of agrochemicals and specialty chemicals.
Formula:C3H7Cl2P
InChI:InChI=1/C3H7Cl2P/c1-2-3-6(4)5/h2-3H2,1H3
SMILES:CCCP(Cl)Cl
Synonyms:- Propylphosphonous Dichloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
