
CAS 155778-83-9
:1-(1,4-Dioxaspiro[4.5]dec-8-yl)-4-methylpiperazine
Description:
1-(1,4-Dioxaspiro[4.5]dec-8-yl)-4-methylpiperazine is a chemical compound characterized by its unique spirocyclic structure, which incorporates a dioxane moiety and a piperazine ring. The presence of the spiro system contributes to its three-dimensional conformation, potentially influencing its biological activity and interactions. The compound features a piperazine ring substituted at one nitrogen with a methyl group, which can enhance its solubility and reactivity. The dioxaspiro structure introduces additional oxygen atoms, which may participate in hydrogen bonding and affect the compound's polarity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including possible applications in neuropharmacology or as a scaffold for drug development. Its molecular characteristics, such as molecular weight, boiling point, and solubility, are influenced by the arrangement of its atoms and functional groups. As with many synthetic compounds, understanding its stability, reactivity, and interaction with biological systems is crucial for evaluating its potential uses in various applications.
Formula:C13H24N2O2
InChI:InChI=1S/C13H24N2O2/c1-14-6-8-15(9-7-14)12-2-4-13(5-3-12)16-10-11-17-13/h12H,2-11H2,1H3
InChI key:InChIKey=AOKPRNQJOUPBTB-UHFFFAOYSA-N
SMILES:CN1CCN(C2CCC3(CC2)OCCO3)CC1
Synonyms:- Piperazine, 1-(1,4-dioxaspiro[4.5]dec-8-yl)-4-methyl-
- 1-(1,4-Dioxaspiro[4.5]dec-8-yl)-4-methylpiperazine
- 1-Methyl-4-(1,4-dioxaspiro[4.5]decan-8-yl)piperazine
- 1-[1,4-Dioxaspiro[4.5]decan-8-yl]-4-methylpiperazine
- 1,4-Dioxaspiro[4.5]decane, piperazine deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
