CAS 155789-84-7
:3,6-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine
Description:
3,6-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine structure, which features a fused ring system containing nitrogen atoms. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of methyl groups at the 3 and 6 positions contributes to its lipophilicity and may influence its interaction with biological targets. The amine functional group at the 2 position can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's molecular structure suggests potential applications in areas such as drug discovery, particularly in the development of agents targeting various diseases. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics.
Formula:C8H10N4
InChI:InChI=1S/C8H10N4/c1-5-3-6-7(10-4-5)12(2)8(9)11-6/h3-4H,1-2H3,(H2,9,11)
InChI key:InChIKey=YDWUSTTVTDTDPJ-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1N)=CC(C)=CN2
Synonyms:- 3,6-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine
- 2-Amino-3,6-dimethylimidazo(4,5-b)pyridine
- 3H-Imidazo[4,5-b]pyridin-2-amine, 3,6-dimethyl-
- 2-Amino-3,6-dimethylimidazo[4,5-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,6-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine
CAS:Controlled ProductFormula:C8H10N4Color and Shape:NeatMolecular weight:162.192

