
CAS 15579-16-5
:Pentathionate
Description:
Pentathionate, with the CAS number 15579-16-5, is a chemical compound that belongs to the class of thionates, which are sulfur-containing anions. It is characterized by its unique structure, which includes a chain of sulfur atoms, typically featuring five sulfur atoms in a linear arrangement. Pentathionate is often encountered in its sodium salt form, sodium pentathionate, which is soluble in water and exhibits a range of interesting chemical properties. This compound is known for its role in various biochemical processes and can act as a reducing agent. Pentathionate is also utilized in analytical chemistry, particularly in the determination of certain metal ions. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Additionally, pentathionate can participate in redox reactions, making it significant in both synthetic and natural chemical pathways. Overall, pentathionate is a notable compound in the field of chemistry due to its unique properties and applications.
Formula:O6S5
InChI:InChI=1S/H2O6S5/c1-10(2,3)8-7-9-11(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2
InChI key:InChIKey=JEIULZGUODBGJK-UHFFFAOYSA-L
SMILES:S(S(=O)(=O)[O-])SSS(=O)(=O)[O-]
Synonyms:- Pentathionate (S5O62-)
- Pentathionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
