CymitQuimica logo

CAS 15579-17-6

:

Trithionate

Description:
Trithionate, with the CAS number 15579-17-6, is a chemical compound that belongs to the class of thionates, which are sulfur-containing anions. It is typically represented as S3O6^2-, indicating that it consists of three sulfur atoms and six oxygen atoms. Trithionate is known for its role in various chemical reactions and processes, particularly in the context of sulfur chemistry. It is often encountered in aqueous solutions and can be formed through the oxidation of sulfite or thiosulfate. The compound exhibits properties such as being a reducing agent and can participate in redox reactions. Trithionate is also of interest in environmental chemistry, as it can be involved in the biogeochemical cycling of sulfur. Its stability and reactivity can vary depending on the pH and the presence of other ions in solution. Overall, trithionate is a significant compound in both industrial applications and natural processes involving sulfur.
Formula:O6S3
InChI:InChI=1S/H2O6S3/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2
InChI key:InChIKey=KRURGYOKPVLRHQ-UHFFFAOYSA-L
SMILES:S(S(=O)(=O)[O-])S(=O)(=O)[O-]
Synonyms:
  • Trithionate (S3O62-)
  • Trithionate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.