CymitQuimica logo

CAS 155814-20-3

:

trans-3,5-bis(trifluoromethyl)cinnamic acid

Description:
Trans-3,5-bis(trifluoromethyl)cinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone with two trifluoromethyl groups attached to the 3 and 5 positions of the phenyl ring. This substitution significantly influences its chemical properties, including increased lipophilicity and altered electronic characteristics due to the electronegative fluorine atoms. The compound typically exhibits a solid state at room temperature and is known for its potential applications in materials science and pharmaceuticals, particularly in the development of fluorinated compounds. Its trans configuration contributes to its stability and influences its reactivity, making it a subject of interest in synthetic organic chemistry. Additionally, the presence of the trifluoromethyl groups can enhance the compound's biological activity and solubility in organic solvents. Overall, trans-3,5-bis(trifluoromethyl)cinnamic acid is notable for its distinctive structural features and potential utility in various chemical applications.
Formula:C11H6F6O2
InChI:InChI=1/C11H6F6O2/c12-10(13,14)7-3-6(1-2-9(18)19)4-8(5-7)11(15,16)17/h1-5H,(H,18,19)/b2-1+
InChI key:IZKCKOPHMWHBHR-OWOJBTEDSA-N
SMILES:C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)/C=C/C(=O)O
Synonyms:
  • 3,5-Bis(trifluoromethyl)cinnamic acid
  • (2E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid
Found 5 products.