CAS 155814-20-3
:trans-3,5-bis(trifluoromethyl)cinnamic acid
Description:
Trans-3,5-bis(trifluoromethyl)cinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone with two trifluoromethyl groups attached to the 3 and 5 positions of the phenyl ring. This substitution significantly influences its chemical properties, including increased lipophilicity and altered electronic characteristics due to the electronegative fluorine atoms. The compound typically exhibits a solid state at room temperature and is known for its potential applications in materials science and pharmaceuticals, particularly in the development of fluorinated compounds. Its trans configuration contributes to its stability and influences its reactivity, making it a subject of interest in synthetic organic chemistry. Additionally, the presence of the trifluoromethyl groups can enhance the compound's biological activity and solubility in organic solvents. Overall, trans-3,5-bis(trifluoromethyl)cinnamic acid is notable for its distinctive structural features and potential utility in various chemical applications.
Formula:C11H6F6O2
InChI:InChI=1/C11H6F6O2/c12-10(13,14)7-3-6(1-2-9(18)19)4-8(5-7)11(15,16)17/h1-5H,(H,18,19)/b2-1+
InChI key:IZKCKOPHMWHBHR-OWOJBTEDSA-N
SMILES:C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)/C=C/C(=O)O
Synonyms:- 3,5-Bis(trifluoromethyl)cinnamic acid
- (2E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
trans-3,5-Bis(trifluoromethyl)cinnamic acid
CAS:trans-3,5-Bis(trifluoromethyl)cinnamic acidFormula:C11H6F6O2Purity:techColor and Shape:Solid-PowderMolecular weight:284.154552-Propenoic acid, 3-[3,5-bis(trifluoromethyl)phenyl]-, (2E)-
CAS:Formula:C11H6F6O2Purity:95%Color and Shape:SolidMolecular weight:284.15463-(3,5-Bis(trifluoromethyl)phenyl)acrylic acid
CAS:Formula:C11H6F6O2Purity:95.0%Color and Shape:SolidMolecular weight:284.1573,5-Bis(trifluoromethyl)cinnamic acid
CAS:3,5-Bis(trifluoromethyl)cinnamic acid is a hydrophobic molecule that can be encapsulated in nanocarriers and used for drug delivery. The encapsulation of hydrophobic molecules in nanocarriers can increase their solubility and stability. 3,5-Bis(trifluoromethyl)cinnamic acid has been shown to form micelles with ethylene oxide chains. Micelles are spherical structures formed by amphiphilic molecules that have both a hydrophobic and a hydrophilic end. This characteristic allows the micelles to self-assemble when they are mixed with water or other polar liquids such as oil. 3,5-Bis(trifluoromethyl)cinnamic acid is also an antagonist at the CXCR1 receptor, which is involved in inflammatory processes.
Formula:C11H6F6O2Purity:Min. 95%Molecular weight:284.15 g/mol




