CymitQuimica logo

CAS 155824-29-6

:

2,4,5-Triamino-6-chloropyrimidine hydrochloride

Description:
2,4,5-Triamino-6-chloropyrimidine hydrochloride is a chemical compound characterized by its pyrimidine ring structure, which is substituted with three amino groups and one chlorine atom. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water. It is known for its potential applications in pharmaceuticals, particularly in the synthesis of various bioactive molecules. The presence of multiple amino groups contributes to its basicity and reactivity, making it a versatile intermediate in organic synthesis. Additionally, the chlorine substituent can influence the compound's electronic properties and reactivity, allowing for further functionalization. As with many nitrogen-containing heterocycles, it may exhibit biological activity, which has been explored in various research contexts. Safety data should be consulted for handling, as it may pose health risks if not managed properly. Overall, 2,4,5-triamino-6-chloropyrimidine hydrochloride is a significant compound in medicinal chemistry and related fields.
Formula:C4H7Cl2N5
InChI:InChI=1/C4H6ClN5.ClH/c5-2-1(6)3(7)10-4(8)9-2;/h6H2,(H4,7,8,9,10);1H
SMILES:c1(c(Cl)[nH]c(=N)[nH]c1=N)N.Cl
Synonyms:
  • 6-Chloro-2,4,5-pyrimidinetriamine monohydrochloride
  • 2,5,6-triaminopyrimidin-4(1H)-one sulfate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.