CAS 155849-49-3
:4-(TRIFLUOROMETHYL)PIPERIDINE HYDROCHLORIDE
Description:
4-(Trifluoromethyl)piperidine hydrochloride is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a trifluoromethyl group (-CF3) at the 4-position of the piperidine ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing the compound's potency in pharmaceutical contexts. Additionally, 4-(trifluoromethyl)piperidine hydrochloride may exhibit interesting interactions with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds. Overall, this compound serves as a valuable building block in the synthesis of more complex molecules in both academic and industrial research settings.
Formula:C6H11ClF3N
InChI:InChI=1/C6H10F3N.ClH/c7-6(8,9)5-1-3-10-4-2-5;/h5,10H,1-4H2;1H
SMILES:C1CNCCC1C(F)(F)F.Cl
Synonyms:- 4-(Trifluoromethyl)Piperidine Hydrochlo&
- 4-(Trifluoromethyl)Piperidine Hcl
- 4-(Trifluoromethyl)Piperidine Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Trifluoromethyl)piperidine hydrochloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H11ClF3NPurity:97%Color and Shape:White to yellow, Crystals or powder or crystalline powderMolecular weight:189.614-(Trifluoromethyl)piperidine hydrochloride
CAS:4-(Trifluoromethyl)piperidine hydrochlorideFormula:C6H10F3N·ClHPurity:≥95%Color and Shape:SolidMolecular weight:189.606444-(Trifluoromethyl)piperidine, HCl
CAS:Formula:C6H11ClF3NPurity:97%Color and Shape:SolidMolecular weight:189.60644-(Trifluoromethyl)piperidine hydrochloride
CAS:Formula:C6H11ClF3NPurity:97%;RGColor and Shape:SolidMolecular weight:189.61



