CAS 155863-31-3
:1-(Bromomethyl)-3-isothiocyanatobenzene
Description:
1-(Bromomethyl)-3-isothiocyanatobenzene, with the CAS number 155863-31-3, is an organic compound characterized by the presence of both a bromomethyl group and an isothiocyanate functional group attached to a benzene ring. This compound typically appears as a solid or liquid, depending on its specific formulation and conditions. The bromomethyl group introduces reactivity, allowing for further chemical modifications, while the isothiocyanate group is known for its ability to participate in nucleophilic reactions and is often utilized in the synthesis of various biologically active compounds. The presence of these functional groups suggests that the compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's properties, such as solubility and stability, can be influenced by the surrounding environment, including temperature and solvent choice. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and reactivity.
Formula:C8H6BrNS
InChI:InChI=1S/C8H6BrNS/c9-5-7-2-1-3-8(4-7)10-6-11/h1-4H,5H2
InChI key:InChIKey=OTUFZEMMKGWNCT-UHFFFAOYSA-N
SMILES:N(=C=S)C1=CC(CBr)=CC=C1
Synonyms:- 1-(Bromomethyl)-3-isothiocyanatobenzene
- Benzene, 1-(bromomethyl)-3-isothiocyanato-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
