CymitQuimica logo

CAS 155906-10-8

:

2-Bromo-1,3-difluoro-5-iodobenzene

Description:
2-Bromo-1,3-difluoro-5-iodobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features a bromine atom, two fluorine atoms, and an iodine atom attached to the benzene structure at the 2, 1, 3, and 5 positions, respectively. This compound is typically a solid at room temperature and exhibits properties common to halogenated aromatics, such as increased density and potential for varied reactivity due to the electronegative halogens. The presence of multiple halogens can influence its chemical behavior, making it useful in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit unique physical properties, such as altered boiling and melting points compared to non-halogenated analogs. Its reactivity can be influenced by the positions and types of halogens, which can affect electrophilic substitution reactions and other chemical transformations. Safety precautions should be taken when handling this compound due to the potential hazards associated with halogenated organic substances.
Formula:C6H2BrF2I
InChI:InChI=1/C6H2BrF2I/c7-6-4(8)1-3(10)2-5(6)9/h1-2H
InChI key:WOLGNRYEQPISPB-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1F)Br)F)I
Synonyms:
  • 4-Bromo-3,5-Difluoroiodobenzene
  • 4-Bromo-3,5-Difluoro-1-Iodobenzene
  • 3,5-Difluoro-4-Bromoiodobenzene
  • 3,5-Difluoro-4-bromo-1-iodobenzene:1-Bromo-2,6-difluoro-4-iodobenzene
  • 1-Bromo-2,6-difluoro-4-iodobenzene
Found 5 products.