CAS 15591-70-5
:methyl 4-(indol-3-yl)butyrate
Description:
Methyl 4-(indol-3-yl)butyrate, with the CAS number 15591-70-5, is an organic compound characterized by its ester functional group, which is derived from the reaction of indole and butyric acid. This compound features a butyrate chain attached to an indole moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant odor, indicative of its potential applications in flavor and fragrance industries. Methyl 4-(indol-3-yl)butyrate is known for its biological activity, including potential roles in various biochemical pathways, which may include antioxidant and anti-inflammatory effects. Its solubility in organic solvents and limited solubility in water make it suitable for various applications in organic synthesis and as a building block in medicinal chemistry. Additionally, the presence of the indole structure suggests potential interactions with biological systems, making it of interest in pharmacological research. Overall, this compound exemplifies the intersection of organic chemistry and biological activity, highlighting its significance in both industrial and research contexts.
Formula:C13H15NO2
InChI:InChI=1S/C13H15NO2/c1-16-13(15)8-4-5-10-9-14-12-7-3-2-6-11(10)12/h2-3,6-7,9,14H,4-5,8H2,1H3
InChI key:InChIKey=ZEJUFCOACOWDPP-UHFFFAOYSA-N
SMILES:C(CCC(OC)=O)C=1C=2C(NC1)=CC=CC2
Synonyms:- 1H-Indole-3-butanoic acid, methyl ester
- 3-Indolebutanoic acid methyl ester
- Indole-3-butyric acid, methyl ester
- Methyl 1H-indole-3-butanoate
- Methyl 4-(3-indolyl)butanoate
- Methyl indole-3-butyrate
- NSC 520394
- methyl 4-(1H-indol-3-yl)butanoate
- Methyl 4-(indol-3-yl)butyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
