CAS 15595-91-2
:(T-4)-(Cyclohexanamine)trifluoroboron
Description:
(T-4)-(Cyclohexanamine)trifluoroboron, identified by its CAS number 15595-91-2, is a chemical compound that features a cyclohexanamine moiety coordinated with a trifluoroboron group. This compound typically exhibits characteristics associated with both amines and boron compounds. Cyclohexanamine, being an amine, contributes basicity and potential nucleophilic reactivity, while the trifluoroboron group introduces unique properties due to the presence of highly electronegative fluorine atoms, which can influence the compound's reactivity and stability. The trifluoroboron moiety can also enhance the compound's solubility in polar solvents and may participate in various coordination chemistry applications. Overall, the combination of these functional groups suggests that (T-4)-(Cyclohexanamine)trifluoroboron could be of interest in fields such as materials science, catalysis, or medicinal chemistry, where the interplay of amine and boron functionalities can lead to novel properties and applications. However, specific safety and handling guidelines should be followed due to the potential hazards associated with both amines and boron compounds.
Formula:C6H13BF3N
InChI:InChI=1S/C6H13BF3N/c8-7(9,10)11-6-4-2-1-3-5-6/h6H,1-5,11H2
InChI key:InChIKey=POUJMUIORHIHHK-UHFFFAOYSA-N
SMILES:[NH2]([B+3]([F-])([F-])[F-])C1CCCCC1
Synonyms:- Boron fluoride (BF3), compd. with cyclohexylamine (1:1)
- Boron, (cyclohexanamine)trifluoro-, (T-4)-
- Cyclohexylamine, compd. with boron fluoride (BF3) (1:1)
- (T-4)-(Cyclohexanamine)trifluoroboron
- Cyclohexanamine, boron complex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
