CymitQuimica logo

CAS 155954-63-5

:

4-Bromo-2-hexylthiophene

Description:
4-Bromo-2-hexylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a hexyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and exhibits good solubility in organic solvents, making it suitable for various applications in organic electronics, such as in organic photovoltaics and field-effect transistors. Its structure allows for effective π-π stacking, which is beneficial for charge transport. Additionally, the bromine substituent can enhance the compound's reactivity and facilitate further chemical modifications. The hexyl chain provides hydrophobic characteristics, influencing the compound's interactions with other materials. Overall, 4-Bromo-2-hexylthiophene is notable for its potential in advanced materials science, particularly in the development of organic semiconductor devices.
Formula:C10H15BrS
InChI:InChI=1/C10H15BrS/c1-2-3-4-5-6-10-7-9(11)8-12-10/h7-8H,2-6H2,1H3
SMILES:CCCCCCc1cc(cs1)Br
Synonyms:
  • Thiophene, 4-Bromo-2-Hexyl-
  • 4-Bromo-2-hexylthiophene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.