
CAS 15596-76-6
:1,4-Benzenedicarboxylic acid, sodium salt (1:?)
Description:
1,4-Benzenedicarboxylic acid, sodium salt, also known as sodium terephthalate, is a sodium salt derivative of terephthalic acid. It is characterized by its white crystalline appearance and is soluble in water, making it useful in various applications. This compound is often utilized in the production of polyesters, particularly polyethylene terephthalate (PET), which is widely used in textiles and plastic bottles. The presence of carboxylate groups in its structure contributes to its ability to form ionic bonds, enhancing its solubility and reactivity. Sodium terephthalate is also employed in the synthesis of various chemical intermediates and can act as a pH buffer in certain formulations. Additionally, it exhibits good thermal stability and resistance to degradation, making it suitable for high-temperature applications. Safety data indicates that it is generally considered to have low toxicity, but standard precautions should be taken when handling any chemical substance. Overall, sodium terephthalate plays a significant role in both industrial and laboratory settings due to its versatile properties.
Formula:C8H6O4·xNa
InChI:InChI=1S/C8H6O4.Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;/h1-4H,(H,9,10)(H,11,12);
InChI key:InChIKey=IISLNQNUYOZKNE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C(O)=O)C=C1.[Na]
Synonyms:- 1,4-Benzenedicarboxylic acid, sodium salt
- 1,4-Benzenedicarboxylic acid, sodium salt (1:?)
- Sodium terephthalate
- Terephthalic acid, sodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
