CymitQuimica logo

CAS 155960-91-1

:

ethyl 3,4-dihydro-4-oxoquinazoline-6-carboxylate

Description:
Ethyl 3,4-dihydro-4-oxoquinazoline-6-carboxylate is a chemical compound characterized by its quinazoline core structure, which features a fused bicyclic system containing both benzene and pyrimidine rings. This compound typically exhibits a range of functional groups, including an ethyl ester and a carbonyl group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the 3,4-dihydro structure indicates that it has a saturated ring system, which can influence its physical properties, such as solubility and stability. Ethyl 3,4-dihydro-4-oxoquinazoline-6-carboxylate may exhibit biological activity, making it of interest for pharmaceutical research, particularly in the development of new therapeutic agents. Its CAS number, 155960-91-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in various chemical and biological contexts. As with many organic compounds, its behavior in reactions can be influenced by factors such as pH, temperature, and the presence of catalysts or other reagents.
Formula:C11H10N2O3
InChI:InChI=1/C11H10N2O3/c1-2-16-11(15)7-3-4-9-8(5-7)10(14)13-6-12-9/h3-6H,2H2,1H3,(H,12,13,14)
InChI key:PLBXHLDCTMXWKA-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc2c(c1)c(ncn2)O
Synonyms:
  • 6-Quinazolinecarboxylic acid, 3,4-dihydro-4-oxo-, ethyl ester
  • Ethyl 4-oxo-3,4-dihydroquinazoline-6-carboxylate
  • ethyl 4-oxo-3H-quinazoline-6-carboxylate
Found 3 products.