CAS 155960-94-4
:Ethyl 4-chloro-6-quinazolinecarboxylate
Description:
Ethyl 4-chloro-6-quinazolinecarboxylate is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a chloro substituent at the 4-position and an ethyl ester group at the carboxylate position, contributing to its reactivity and potential applications in medicinal chemistry. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro group can enhance its electrophilic character, making it a useful intermediate in various synthetic pathways. Ethyl 4-chloro-6-quinazolinecarboxylate has garnered interest for its potential biological activities, including antitumor and antimicrobial properties, although specific biological data may vary. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity. Overall, this compound represents a valuable scaffold in the development of pharmaceuticals and agrochemicals.
Formula:C11H9ClN2O2
InChI:InChI=1S/C11H9ClN2O2/c1-2-16-11(15)7-3-4-9-8(5-7)10(12)14-6-13-9/h3-6H,2H2,1H3
InChI key:InChIKey=ADKCJHRCXSXELJ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(C(OCC)=O)=C2)N=CN1
Synonyms:- 6-Quinazolinecarboxylic Acid, 4-Chloro-, Ethyl Ester
- Ethyl 4-chloro-6-quinazolinecarboxylate
- Ethyl 4-chloroquinazoline-6-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 4-chloroquinazoline-6-carboxylate
CAS:Ethyl 4-chloroquinazoline-6-carboxylateFormula:C11H9ClN2O2Purity:95%Molecular weight:236.666-Quinazolinecarboxylic acid, 4-chloro-, ethyl ester
CAS:Formula:C11H9ClN2O2Purity:95%Color and Shape:SolidMolecular weight:236.6544Ethyl 4-chloroquinazoline-6-carboxylate
CAS:Ethyl 4-chloroquinazoline-6-carboxylateFormula:C11H9ClN2O2Purity:95%Molecular weight:236.65Ethyl 4-chloroquinazoline-6-carboxylate
CAS:Ethyl 4-chloroquinazoline-6-carboxylate is a reagent that is used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is a versatile building block that can be used as an intermediate or a building block in the synthesis of complex compounds. This chemical has been shown to be useful for the synthesis of 2,4-dichlorothiazole, which is used to make herbicides.Formula:C11H9ClN2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:236.65 g/molEthyl 4-chloroquinazoline-6-carboxylate
CAS:Formula:C11H9ClN2O2Purity:95%Color and Shape:SolidMolecular weight:236.66




