CAS 155988-33-3
:trans-2-bromo-beta-nitrostyrene
Description:
Trans-2-bromo-beta-nitrostyrene is an organic compound characterized by its unique structural features, including a bromine atom and a nitro group attached to a styrene backbone. This compound typically exhibits a trans configuration, meaning that the substituents (bromo and nitro groups) are positioned on opposite sides of the double bond in the styrene moiety. The presence of the nitro group contributes to its reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, the bromine atom serves as a useful handle for further functionalization. Trans-2-bromo-beta-nitrostyrene is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Safety precautions should be observed when handling this substance, as both brominated compounds and nitro compounds can pose health risks.
Formula:C8H6BrNO2
InChI:InChI=1/C8H6BrNO2/c9-8-4-2-1-3-7(8)5-6-10(11)12/h1-6H/b6-5+
Synonyms:- Trans-2-Bromo-Β-Nitrostyrene
- 1-bromo-2-[(E)-2-nitroethenyl]benzene
- trans-2-Bromo-beta-nitrostyrene 95%
- TRANS-2-BROMO-BETA-NITROSTYRENE 95
- E-2-Bromo-beta-nitrostyrene
- Benzene, 1-bromo-2-[(1E)-2-nitroethenyl]-
- (E)-1-Bromo-2-(2-nitroethenyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-1-Bromo-2-(2-Nitrovinyl)Benzene
CAS:(E)-1-Bromo-2-(2-Nitrovinyl)BenzeneFormula:C8H6BrNO2Purity:95%Molecular weight:228.04trans-2-Bromo-β-nitrostyrene
CAS:Formula:C8H6BrNO2Purity:98%Color and Shape:SolidMolecular weight:228.04271-(2-Bromophenyl)-2-nitroethene
CAS:1-(2-Bromophenyl)-2-nitroethene is a chiral, enantioselective nitroalkene that is used in the synthesis of many biologically active compounds. The compound was found to be an effective chiral ligand for asymmetric reactions involving aldehydes, indoles, and bipyridine. It has been shown to be more reactive than other bromoalkyltin reagents and can be used in a variety of reactions. 1-(2-Bromophenyl)-2-nitroethene also has conformationally rigid skeletons, which may allow for higher yields when compared with other alkylation agents.
Formula:C8H6BrNO2Purity:Min. 95%Molecular weight:228.04 g/mol





